C25H25NO4S — CID 10765339
ethyl (2R,3R,4R)-1-(4-methylphenyl)sulfonyl-3,4-diphenylazetidine-2-carboxylate (PubChem CID 10765339) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is ethyl (2R,3R,4R)-1-(4-methylphenyl)sulfonyl-3,4-diphenylazetidine-2-carboxylate.
| Compound Name | ethyl (2R,3R,4R)-1-(4-methylphenyl)sulfonyl-3,4-diphenylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 10765339 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | ethyl (2R,3R,4R)-1-(4-methylphenyl)sulfonyl-3,4-diphenylazetidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccccc2)[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-3-30-25(27)24-22(19-10-6-4-7-11-19)23(20-12-8-5-9-13-20)26(24)31(28,29)21-16-14-18(2)15-17-21/h4-17,22-24H,3H2,1-2H3/t22-,23+,24-/m1/s1 |
| InChIKey | YYSWZCDEALAXMN-TZRRMPRUSA-N |
| XLogP | 4.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |