C14H16Cl2N2O2 — CID 107653735
1-tert-butyl-3-(2,5-dichlorophenyl)-1,3-diazinane-2,4-dione (PubChem CID 107653735) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,5-dichlorophenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-tert-butyl-3-(2,5-dichlorophenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 107653735 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-tert-butyl-3-(2,5-dichlorophenyl)-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)N1CCC(=O)N(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C14H16Cl2N2O2/c1-14(2,3)17-7-6-12(19)18(13(17)20)11-8-9(15)4-5-10(11)16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | BKJSIDMJQPKHBZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |