C14H10BrCl2NO3 — CID 107659951
methyl 5-amino-2-(4-bromo-2,5-dichlorophenoxy)benzoate (PubChem CID 107659951) has the molecular formula C14H10BrCl2NO3 and a molecular weight of 391.05 g/mol. Its IUPAC name is methyl 5-amino-2-(4-bromo-2,5-dichlorophenoxy)benzoate.
| Compound Name | methyl 5-amino-2-(4-bromo-2,5-dichlorophenoxy)benzoate |
|---|---|
| PubChem CID | 107659951 |
| Molecular Formula | C14H10BrCl2NO3 |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | methyl 5-amino-2-(4-bromo-2,5-dichlorophenoxy)benzoate |
| SMILES | COC(=O)c1cc(N)ccc1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C14H10BrCl2NO3/c1-20-14(19)8-4-7(18)2-3-12(8)21-13-6-10(16)9(15)5-11(13)17/h2-6H,18H2,1H3 |
| InChIKey | YONTZRXAIDZXSG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|