About 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine
5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine (PubChem CID 107660117) has the molecular formula C11H4Br2Cl2N2O3
and a molecular weight of 442.88 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine.
Molecular Properties
| Compound Name | 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine |
| PubChem CID | 107660117 |
| Molecular Formula | C11H4Br2Cl2N2O3 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 439.80 |
| IUPAC Name | 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C11H4Br2Cl2N2O3/c12-5-1-9(17(18)19)11(16-4-5)20-10-3-7(14)6(13)2-8(10)15/h1-4H |
| InChIKey | LNRQNRQARNRLQP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine?
The IUPAC name of 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine (CID 107660117) is 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine.
What is the SMILES notation for 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine?
The canonical SMILES for 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine is O=[N+]([O-])c1cc(Br)cnc1Oc1cc(Cl)c(Br)cc1Cl.
What is the InChIKey of 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine?
The InChIKey is LNRQNRQARNRLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H4Br2Cl2N2O3/c12-5-1-9(17(18)19)11(16-4-5)20-10-3-7(14)6(13)2-8(10)15/h1-4H.
What are the key properties of 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine?
5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine has a molecular weight of 442.88 g/mol, XLogP of 5.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(4-bromo-2,5-dichlorophenoxy)-3-nitropyridine is sourced from PubChem (CID 107660117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).