C12H8Br2N2O3 — CID 113413888
3,5-dibromo-2-(5-methyl-2-nitrophenoxy)pyridine (PubChem CID 113413888) has the molecular formula C12H8Br2N2O3 and a molecular weight of 388.02 g/mol. Its IUPAC name is 3,5-dibromo-2-(5-methyl-2-nitrophenoxy)pyridine.
| Compound Name | 3,5-dibromo-2-(5-methyl-2-nitrophenoxy)pyridine |
|---|---|
| PubChem CID | 113413888 |
| Molecular Formula | C12H8Br2N2O3 |
| Molecular Weight | 388.02 g/mol |
| Exact Mass | 385.89 |
| IUPAC Name | 3,5-dibromo-2-(5-methyl-2-nitrophenoxy)pyridine |
| SMILES | Cc1ccc([N+](=O)[O-])c(Oc2ncc(Br)cc2Br)c1 |
| InChI | InChI=1S/C12H8Br2N2O3/c1-7-2-3-10(16(17)18)11(4-7)19-12-9(14)5-8(13)6-15-12/h2-6H,1H3 |
| InChIKey | GUEQCULHVZTNPU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.02 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|