C13H19FO2 — CID 107660344
1-(2-fluoro-3-methylphenoxy)-3-methylpentan-2-ol (PubChem CID 107660344) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-(2-fluoro-3-methylphenoxy)-3-methylpentan-2-ol.
| Compound Name | 1-(2-fluoro-3-methylphenoxy)-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 107660344 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-(2-fluoro-3-methylphenoxy)-3-methylpentan-2-ol |
| SMILES | CCC(C)C(O)COc1cccc(C)c1F |
| InChI | InChI=1S/C13H19FO2/c1-4-9(2)11(15)8-16-12-7-5-6-10(3)13(12)14/h5-7,9,11,15H,4,8H2,1-3H3 |
| InChIKey | WLGRRMYXYZRALR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |