C21H27BrNOPS — CID 10766039
N-[[3-(4-bromophenoxy)phenyl]methyl]-2,2,3,4,4-pentamethyl-1-sulfanylidene-1λ5-phosphetan-1-amine (PubChem CID 10766039) has the molecular formula C21H27BrNOPS and a molecular weight of 452.40 g/mol. Its IUPAC name is N-[[3-(4-bromophenoxy)phenyl]methyl]-2,2,3,4,4-pentamethyl-1-sulfanylidene-1λ5-phosphetan-1-amine.
| Compound Name | N-[[3-(4-bromophenoxy)phenyl]methyl]-2,2,3,4,4-pentamethyl-1-sulfanylidene-1λ5-phosphetan-1-amine |
|---|---|
| PubChem CID | 10766039 |
| Molecular Formula | C21H27BrNOPS |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[[3-(4-bromophenoxy)phenyl]methyl]-2,2,3,4,4-pentamethyl-1-sulfanylidene-1λ5-phosphetan-1-amine |
| SMILES | CC1C(C)(C)P(=S)(NCc2cccc(Oc3ccc(Br)cc3)c2)C1(C)C |
| InChI | InChI=1S/C21H27BrNOPS/c1-15-20(2,3)25(26,21(15,4)5)23-14-16-7-6-8-19(13-16)24-18-11-9-17(22)10-12-18/h6-13,15H,14H2,1-5H3,(H,23,26) |
| InChIKey | GCWCNIWCVGYKES-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|