C14H11BrCl2FNO — CID 107661382
N-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2-fluoroaniline (PubChem CID 107661382) has the molecular formula C14H11BrCl2FNO and a molecular weight of 379.06 g/mol. Its IUPAC name is N-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2-fluoroaniline.
| Compound Name | N-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 107661382 |
| Molecular Formula | C14H11BrCl2FNO |
| Molecular Weight | 379.06 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | N-[2-(4-bromo-2,5-dichlorophenoxy)ethyl]-2-fluoroaniline |
| SMILES | Fc1ccccc1NCCOc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C14H11BrCl2FNO/c15-9-7-11(17)14(8-10(9)16)20-6-5-19-13-4-2-1-3-12(13)18/h1-4,7-8,19H,5-6H2 |
| InChIKey | CAQBUWNLCRZVRZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.06 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|