C16H16BrCl2NO — CID 107661682
1-[2-(4-bromo-2,5-dichlorophenoxy)phenyl]butan-2-amine (PubChem CID 107661682) has the molecular formula C16H16BrCl2NO and a molecular weight of 389.12 g/mol. Its IUPAC name is 1-[2-(4-bromo-2,5-dichlorophenoxy)phenyl]butan-2-amine.
| Compound Name | 1-[2-(4-bromo-2,5-dichlorophenoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 107661682 |
| Molecular Formula | C16H16BrCl2NO |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 1-[2-(4-bromo-2,5-dichlorophenoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccccc1Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C16H16BrCl2NO/c1-2-11(20)7-10-5-3-4-6-15(10)21-16-9-13(18)12(17)8-14(16)19/h3-6,8-9,11H,2,7,20H2,1H3 |
| InChIKey | URVPETWTMWMOMU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|