C18H24ClNO — CID 170889352
1-[2-(3,5-dimethylphenoxy)phenyl]butan-2-amine;hydrochloride (PubChem CID 170889352) has the molecular formula C18H24ClNO and a molecular weight of 305.85 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889352 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)phenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccccc1Oc1cc(C)cc(C)c1.Cl |
| InChI | InChI=1S/C18H23NO.ClH/c1-4-16(19)12-15-7-5-6-8-18(15)20-17-10-13(2)9-14(3)11-17;/h5-11,16H,4,12,19H2,1-3H3;1H |
| InChIKey | NBKIPUFMNHKKBR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |