C15H18BrCl2NO2 — CID 107662994
N-[[5-bromo-4,7-dichloro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 107662994) has the molecular formula C15H18BrCl2NO2 and a molecular weight of 395.12 g/mol. Its IUPAC name is N-[[5-bromo-4,7-dichloro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-bromo-4,7-dichloro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107662994 |
| Molecular Formula | C15H18BrCl2NO2 |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-[[5-bromo-4,7-dichloro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | COCc1c(CNCC(C)C)oc2c(Cl)cc(Br)c(Cl)c12 |
| InChI | InChI=1S/C15H18BrCl2NO2/c1-8(2)5-19-6-12-9(7-20-3)13-14(18)10(16)4-11(17)15(13)21-12/h4,8,19H,5-7H2,1-3H3 |
| InChIKey | SZAKAFRYFAXTNQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|