C14H7Cl2FO2 — CID 107663435
2,5-dichloro-4-(7-fluoro-1-benzofuran-2-yl)phenol (PubChem CID 107663435) has the molecular formula C14H7Cl2FO2 and a molecular weight of 297.11 g/mol. Its IUPAC name is 2,5-dichloro-4-(7-fluoro-1-benzofuran-2-yl)phenol.
| Compound Name | 2,5-dichloro-4-(7-fluoro-1-benzofuran-2-yl)phenol |
|---|---|
| PubChem CID | 107663435 |
| Molecular Formula | C14H7Cl2FO2 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 2,5-dichloro-4-(7-fluoro-1-benzofuran-2-yl)phenol |
| SMILES | Oc1cc(Cl)c(-c2cc3cccc(F)c3o2)cc1Cl |
| InChI | InChI=1S/C14H7Cl2FO2/c15-9-6-12(18)10(16)5-8(9)13-4-7-2-1-3-11(17)14(7)19-13/h1-6,18H |
| InChIKey | WXGMQTFZMQWMFU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |