C24H22N2O3 — CID 1076653
2,4,5-tris(4-methoxyphenyl)-1H-imidazole (PubChem CID 1076653) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2,4,5-tris(4-methoxyphenyl)-1H-imidazole.
| Compound Name | 2,4,5-tris(4-methoxyphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 1076653 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2,4,5-tris(4-methoxyphenyl)-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-27-19-10-4-16(5-11-19)22-23(17-6-12-20(28-2)13-7-17)26-24(25-22)18-8-14-21(29-3)15-9-18/h4-15H,1-3H3,(H,25,26) |
| InChIKey | RKJRANQNAKBIFU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|