C15H16FNO4 — CID 107666565
ethyl 4-(4-cyano-2-fluorophenoxy)-2,2-dimethyl-3-oxobutanoate (PubChem CID 107666565) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is ethyl 4-(4-cyano-2-fluorophenoxy)-2,2-dimethyl-3-oxobutanoate.
| Compound Name | ethyl 4-(4-cyano-2-fluorophenoxy)-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 107666565 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | ethyl 4-(4-cyano-2-fluorophenoxy)-2,2-dimethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)COc1ccc(C#N)cc1F |
| InChI | InChI=1S/C15H16FNO4/c1-4-20-14(19)15(2,3)13(18)9-21-12-6-5-10(8-17)7-11(12)16/h5-7H,4,9H2,1-3H3 |
| InChIKey | WGFWJMBBUXSOMH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|