C27H44N2O5 — CID 10766969
ethyl (2S)-2-[[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoyl]amino]-3-phenylpropanoate (PubChem CID 10766969) has the molecular formula C27H44N2O5 and a molecular weight of 476.66 g/mol. Its IUPAC name is ethyl (2S)-2-[[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10766969 |
| Molecular Formula | C27H44N2O5 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | ethyl (2S)-2-[[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoyl]amino]-3-phenylpropanoate |
| SMILES | CCCCCCC(NC(=O)OC(C)(C)C)C(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C27H44N2O5/c1-8-10-11-15-18-22(29-25(32)34-26(3,4)5)27(6,7)24(31)28-21(23(30)33-9-2)19-20-16-13-12-14-17-20/h12-14,16-17,21-22H,8-11,15,18-19H2,1-7H3,(H,28,31)(H,29,32)/t21-,22?/m0/s1 |
| InChIKey | KEVSTWADIXQVCS-HMTLIYDFSA-N |
| XLogP | 5.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|