C11H8FN5O — CID 107669861
3-fluoro-4-(6-hydrazinylpyrimidin-4-yl)oxybenzonitrile (PubChem CID 107669861) has the molecular formula C11H8FN5O and a molecular weight of 245.22 g/mol. Its IUPAC name is 3-fluoro-4-(6-hydrazinylpyrimidin-4-yl)oxybenzonitrile.
| Compound Name | 3-fluoro-4-(6-hydrazinylpyrimidin-4-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 107669861 |
| Molecular Formula | C11H8FN5O |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-fluoro-4-(6-hydrazinylpyrimidin-4-yl)oxybenzonitrile |
| SMILES | N#Cc1ccc(Oc2cc(NN)ncn2)c(F)c1 |
| InChI | InChI=1S/C11H8FN5O/c12-8-3-7(5-13)1-2-9(8)18-11-4-10(17-14)15-6-16-11/h1-4,6H,14H2,(H,15,16,17) |
| InChIKey | PJEJAAYJXCOJDT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|