C10H6FN3O2 — CID 107670454
3-fluoro-4-(1,2,4-oxadiazol-3-ylmethoxy)benzonitrile (PubChem CID 107670454) has the molecular formula C10H6FN3O2 and a molecular weight of 219.18 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,4-oxadiazol-3-ylmethoxy)benzonitrile.
| Compound Name | 3-fluoro-4-(1,2,4-oxadiazol-3-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 107670454 |
| Molecular Formula | C10H6FN3O2 |
| Molecular Weight | 219.18 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 3-fluoro-4-(1,2,4-oxadiazol-3-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCc2ncon2)c(F)c1 |
| InChI | InChI=1S/C10H6FN3O2/c11-8-3-7(4-12)1-2-9(8)15-5-10-13-6-16-14-10/h1-3,6H,5H2 |
| InChIKey | NZGKSHOONWQFQF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |