C14H19NO5 — CID 107673588
4-[2-(1-methoxypropan-2-ylamino)-2-oxoethoxy]-3-methylbenzoic acid (PubChem CID 107673588) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[2-(1-methoxypropan-2-ylamino)-2-oxoethoxy]-3-methylbenzoic acid.
| Compound Name | 4-[2-(1-methoxypropan-2-ylamino)-2-oxoethoxy]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 107673588 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[2-(1-methoxypropan-2-ylamino)-2-oxoethoxy]-3-methylbenzoic acid |
| SMILES | COCC(C)NC(=O)COc1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C14H19NO5/c1-9-6-11(14(17)18)4-5-12(9)20-8-13(16)15-10(2)7-19-3/h4-6,10H,7-8H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | NWLCRPIHBVIXSY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |