C15H24N2O3 — CID 63367325
2-[2-[(1R)-1-aminoethyl]-4-methylphenoxy]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 63367325) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[2-[(1R)-1-aminoethyl]-4-methylphenoxy]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[2-[(1R)-1-aminoethyl]-4-methylphenoxy]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 63367325 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[2-[(1R)-1-aminoethyl]-4-methylphenoxy]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)COc1ccc(C)cc1[C@@H](C)N |
| InChI | InChI=1S/C15H24N2O3/c1-10-5-6-14(13(7-10)12(3)16)20-9-15(18)17-11(2)8-19-4/h5-7,11-12H,8-9,16H2,1-4H3,(H,17,18)/t11?,12-/m1/s1 |
| InChIKey | ALCFTQFADDKOEA-PIJUOVFKSA-N |
| XLogP | 1.54 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |