C13H19NO3 — CID 78955036
methyl 3-[2-[(1S)-1-aminoethyl]-4-methylphenoxy]propanoate (PubChem CID 78955036) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 3-[2-[(1S)-1-aminoethyl]-4-methylphenoxy]propanoate.
| Compound Name | methyl 3-[2-[(1S)-1-aminoethyl]-4-methylphenoxy]propanoate |
|---|---|
| PubChem CID | 78955036 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl 3-[2-[(1S)-1-aminoethyl]-4-methylphenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(C)cc1[C@H](C)N |
| InChI | InChI=1S/C13H19NO3/c1-9-4-5-12(11(8-9)10(2)14)17-7-6-13(15)16-3/h4-5,8,10H,6-7,14H2,1-3H3/t10-/m0/s1 |
| InChIKey | QCHOEDDRZFRUFY-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |