C14H20BrNO4 — CID 62379921
2-[4-bromo-2-(1-hydroxyethyl)phenoxy]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 62379921) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-[4-bromo-2-(1-hydroxyethyl)phenoxy]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[4-bromo-2-(1-hydroxyethyl)phenoxy]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 62379921 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-[4-bromo-2-(1-hydroxyethyl)phenoxy]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)COc1ccc(Br)cc1C(C)O |
| InChI | InChI=1S/C14H20BrNO4/c1-9(7-19-3)16-14(18)8-20-13-5-4-11(15)6-12(13)10(2)17/h4-6,9-10,17H,7-8H2,1-3H3,(H,16,18) |
| InChIKey | HKAZGVRNAUSTAR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |