C15H22BrNO3 — CID 78932283
2-[4-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 78932283) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is 2-[4-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[4-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 78932283 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[4-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)COc1ccc(Br)cc1[C@H](C)O |
| InChI | InChI=1S/C15H22BrNO3/c1-5-15(3,4)17-14(19)9-20-13-7-6-11(16)8-12(13)10(2)18/h6-8,10,18H,5,9H2,1-4H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | BMTWXBDZTCPYJL-JTQLQIEISA-N |
| XLogP | 3.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |