C16H25NO4 — CID 82002849
2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 82002849) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 82002849 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)COc1cc(OC)ccc1[C@@H](C)O |
| InChI | InChI=1S/C16H25NO4/c1-6-16(3,4)17-15(19)10-21-14-9-12(20-5)7-8-13(14)11(2)18/h7-9,11,18H,6,10H2,1-5H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | WTDUNKRBACXXAE-LLVKDONJSA-N |
| XLogP | 2.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |