C15H23BrN2O3 — CID 62392944
2-[4-bromo-2-[1-(methylamino)ethyl]phenoxy]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 62392944) has the molecular formula C15H23BrN2O3 and a molecular weight of 359.26 g/mol. Its IUPAC name is 2-[4-bromo-2-[1-(methylamino)ethyl]phenoxy]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[4-bromo-2-[1-(methylamino)ethyl]phenoxy]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 62392944 |
| Molecular Formula | C15H23BrN2O3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[4-bromo-2-[1-(methylamino)ethyl]phenoxy]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | CNC(C)c1cc(Br)ccc1OCC(=O)NC(C)COC |
| InChI | InChI=1S/C15H23BrN2O3/c1-10(8-20-4)18-15(19)9-21-14-6-5-12(16)7-13(14)11(2)17-3/h5-7,10-11,17H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | MZMCJIUMFFSEPI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |