C15H22FN3O2 — CID 107674352
[4-(3-amino-2-methylpropyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone (PubChem CID 107674352) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is [4-(3-amino-2-methylpropyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone.
| Compound Name | [4-(3-amino-2-methylpropyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107674352 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [4-(3-amino-2-methylpropyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone |
| SMILES | CC(CN)CN1CCN(C(=O)c2ccc(O)cc2F)CC1 |
| InChI | InChI=1S/C15H22FN3O2/c1-11(9-17)10-18-4-6-19(7-5-18)15(21)13-3-2-12(20)8-14(13)16/h2-3,8,11,20H,4-7,9-10,17H2,1H3 |
| InChIKey | ISHRGGLJEPOERL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |