C17H17ClFN3O2 — CID 86788723
[4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone (PubChem CID 86788723) has the molecular formula C17H17ClFN3O2 and a molecular weight of 349.79 g/mol. Its IUPAC name is [4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone.
| Compound Name | [4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 86788723 |
| Molecular Formula | C17H17ClFN3O2 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1F)N1CCN(Cc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17ClFN3O2/c18-12-1-2-13(20-10-12)11-21-5-7-22(8-6-21)17(24)15-4-3-14(23)9-16(15)19/h1-4,9-10,23H,5-8,11H2 |
| InChIKey | SFPDNFLETAHFNG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |