C14H16FNO4 — CID 107675551
2-fluoro-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)oxybenzoic acid (PubChem CID 107675551) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-fluoro-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)oxybenzoic acid.
| Compound Name | 2-fluoro-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 107675551 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-fluoro-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)oxybenzoic acid |
| SMILES | CC(Oc1ccc(C(=O)O)c(F)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H16FNO4/c1-9(13(17)16-6-2-3-7-16)20-10-4-5-11(14(18)19)12(15)8-10/h4-5,8-9H,2-3,6-7H2,1H3,(H,18,19) |
| InChIKey | JDJRQYIEXNPYTF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |