C15H20FNO3 — CID 107720649
2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 107720649) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 107720649 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(Oc1ccc([C@H](C)O)c(F)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C15H20FNO3/c1-10(18)13-6-5-12(9-14(13)16)20-11(2)15(19)17-7-3-4-8-17/h5-6,9-11,18H,3-4,7-8H2,1-2H3/t10-,11?/m0/s1 |
| InChIKey | UVWLMCRTGCOUHO-VUWPPUDQSA-N |
| XLogP | 2.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |