C11H12FNO2 — CID 107676829
N-but-3-enyl-2-fluoro-4-hydroxybenzamide (PubChem CID 107676829) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is N-but-3-enyl-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-but-3-enyl-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 107676829 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-but-3-enyl-2-fluoro-4-hydroxybenzamide |
| SMILES | C=CCCNC(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C11H12FNO2/c1-2-3-6-13-11(15)9-5-4-8(14)7-10(9)12/h2,4-5,7,14H,1,3,6H2,(H,13,15) |
| InChIKey | BZPTTXOAXNMUBI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|