C11H13BrFNO2 — CID 107677727
N-(2-bromobutyl)-2-fluoro-4-hydroxybenzamide (PubChem CID 107677727) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is N-(2-bromobutyl)-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-(2-bromobutyl)-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 107677727 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | N-(2-bromobutyl)-2-fluoro-4-hydroxybenzamide |
| SMILES | CCC(Br)CNC(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C11H13BrFNO2/c1-2-7(12)6-14-11(16)9-4-3-8(15)5-10(9)13/h3-5,7,15H,2,6H2,1H3,(H,14,16) |
| InChIKey | GNWQGWDMQNKLOY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|