C11H16ClNO3 — CID 107678609
2-chloro-4-(1,1-dimethoxypropan-2-ylamino)phenol (PubChem CID 107678609) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-chloro-4-(1,1-dimethoxypropan-2-ylamino)phenol.
| Compound Name | 2-chloro-4-(1,1-dimethoxypropan-2-ylamino)phenol |
|---|---|
| PubChem CID | 107678609 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-chloro-4-(1,1-dimethoxypropan-2-ylamino)phenol |
| SMILES | COC(OC)C(C)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H16ClNO3/c1-7(11(15-2)16-3)13-8-4-5-10(14)9(12)6-8/h4-7,11,13-14H,1-3H3 |
| InChIKey | VEWZDIHGYPRABR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|