C11H15Cl2NO2 — CID 65468927
2,6-dichloro-N-(1,1-dimethoxypropan-2-yl)aniline (PubChem CID 65468927) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 2,6-dichloro-N-(1,1-dimethoxypropan-2-yl)aniline.
| Compound Name | 2,6-dichloro-N-(1,1-dimethoxypropan-2-yl)aniline |
|---|---|
| PubChem CID | 65468927 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2,6-dichloro-N-(1,1-dimethoxypropan-2-yl)aniline |
| SMILES | COC(OC)C(C)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c1-7(11(15-2)16-3)14-10-8(12)5-4-6-9(10)13/h4-7,11,14H,1-3H3 |
| InChIKey | BLUBOHRVUSEMRK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|