C17H19Cl2N — CID 65469512
2,6-dichloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline (PubChem CID 65469512) has the molecular formula C17H19Cl2N and a molecular weight of 308.25 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline.
| Compound Name | 2,6-dichloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 65469512 |
| Molecular Formula | C17H19Cl2N |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2,6-dichloro-N-[1-(2,4,6-trimethylphenyl)ethyl]aniline |
| SMILES | Cc1cc(C)c(C(C)Nc2c(Cl)cccc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H19Cl2N/c1-10-8-11(2)16(12(3)9-10)13(4)20-17-14(18)6-5-7-15(17)19/h5-9,13,20H,1-4H3 |
| InChIKey | XKBKMLJBXFXSCY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |