(2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid

C11H13Cl2NO2 — CID 54414123

IUPAC(2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid
SMILESCC(C)[C@H](Nc1c(Cl)cccc1Cl)C(=O)O
InChIInChI=1S/C11H13Cl2NO2/c1-6(2)9(11(15)16)14-10-7(12)4-3-5-8(10)13/h3-6,9,14H,1-2H3,(H,15,16)/t9-/m0/s1
InChIKeyVWECIPUUTBEHCX-VIFPVBQESA-N
MW262.14 g/mol
LogP3.51
Rot. Bonds4

About (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid

(2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid (PubChem CID 54414123) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid.

Molecular Properties

Compound Name(2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid
PubChem CID54414123
Molecular FormulaC11H13Cl2NO2
Molecular Weight262.14 g/mol
Exact Mass261.03
IUPAC Name(2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid
SMILESCC(C)[C@H](Nc1c(Cl)cccc1Cl)C(=O)O
InChIInChI=1S/C11H13Cl2NO2/c1-6(2)9(11(15)16)14-10-7(12)4-3-5-8(10)13/h3-6,9,14H,1-2H3,(H,15,16)/t9-/m0/s1
InChIKeyVWECIPUUTBEHCX-VIFPVBQESA-N
XLogP3.51
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.14
LogP ≤ 53.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid?
The IUPAC name of (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid (CID 54414123) is (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid.
What is the SMILES notation for (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid?
The canonical SMILES for (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid is CC(C)[C@H](Nc1c(Cl)cccc1Cl)C(=O)O.
What is the InChIKey of (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid?
The InChIKey is VWECIPUUTBEHCX-VIFPVBQESA-N. The full InChI is InChI=1S/C11H13Cl2NO2/c1-6(2)9(11(15)16)14-10-7(12)4-3-5-8(10)13/h3-6,9,14H,1-2H3,(H,15,16)/t9-/m0/s1.
What are the key properties of (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid?
(2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid has a molecular weight of 262.14 g/mol, XLogP of 3.51, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,6-dichloroanilino)-3-methylbutanoic acid is sourced from PubChem (CID 54414123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).