C16H14Cl2FNO — CID 107679299
2,6-dichloro-4-[[3-(3-fluorophenyl)cyclobutyl]amino]phenol (PubChem CID 107679299) has the molecular formula C16H14Cl2FNO and a molecular weight of 326.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[[3-(3-fluorophenyl)cyclobutyl]amino]phenol.
| Compound Name | 2,6-dichloro-4-[[3-(3-fluorophenyl)cyclobutyl]amino]phenol |
|---|---|
| PubChem CID | 107679299 |
| Molecular Formula | C16H14Cl2FNO |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2,6-dichloro-4-[[3-(3-fluorophenyl)cyclobutyl]amino]phenol |
| SMILES | Oc1c(Cl)cc(NC2CC(c3cccc(F)c3)C2)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO/c17-14-7-13(8-15(18)16(14)21)20-12-5-10(6-12)9-2-1-3-11(19)4-9/h1-4,7-8,10,12,20-21H,5-6H2 |
| InChIKey | YXRKKGAOTGHPJM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|