C16H13Cl3FN — CID 43633053
2,4,5-trichloro-N-[3-(3-fluorophenyl)cyclobutyl]aniline (PubChem CID 43633053) has the molecular formula C16H13Cl3FN and a molecular weight of 344.64 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[3-(3-fluorophenyl)cyclobutyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[3-(3-fluorophenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 43633053 |
| Molecular Formula | C16H13Cl3FN |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2,4,5-trichloro-N-[3-(3-fluorophenyl)cyclobutyl]aniline |
| SMILES | Fc1cccc(C2CC(Nc3cc(Cl)c(Cl)cc3Cl)C2)c1 |
| InChI | InChI=1S/C16H13Cl3FN/c17-13-7-15(19)16(8-14(13)18)21-12-5-10(6-12)9-2-1-3-11(20)4-9/h1-4,7-8,10,12,21H,5-6H2 |
| InChIKey | OPLPIVSJFHAKFE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|