C17H16FNO2 — CID 43635194
2-[[3-(3-fluorophenyl)cyclobutyl]amino]benzoic acid (PubChem CID 43635194) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-[[3-(3-fluorophenyl)cyclobutyl]amino]benzoic acid.
| Compound Name | 2-[[3-(3-fluorophenyl)cyclobutyl]amino]benzoic acid |
|---|---|
| PubChem CID | 43635194 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[[3-(3-fluorophenyl)cyclobutyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC1CC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H16FNO2/c18-13-5-3-4-11(8-13)12-9-14(10-12)19-16-7-2-1-6-15(16)17(20)21/h1-8,12,14,19H,9-10H2,(H,20,21) |
| InChIKey | QEDKHIDIVYFZJA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |