C16H14Br2FN — CID 43736844
2,5-dibromo-N-[3-(3-fluorophenyl)cyclobutyl]aniline (PubChem CID 43736844) has the molecular formula C16H14Br2FN and a molecular weight of 399.10 g/mol. Its IUPAC name is 2,5-dibromo-N-[3-(3-fluorophenyl)cyclobutyl]aniline.
| Compound Name | 2,5-dibromo-N-[3-(3-fluorophenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 43736844 |
| Molecular Formula | C16H14Br2FN |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | 2,5-dibromo-N-[3-(3-fluorophenyl)cyclobutyl]aniline |
| SMILES | Fc1cccc(C2CC(Nc3cc(Br)ccc3Br)C2)c1 |
| InChI | InChI=1S/C16H14Br2FN/c17-12-4-5-15(18)16(9-12)20-14-7-11(8-14)10-2-1-3-13(19)6-10/h1-6,9,11,14,20H,7-8H2 |
| InChIKey | NDPPNMAVLBEUPV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |