C16H21Cl2NO — CID 107679442
2,6-dichloro-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]phenol (PubChem CID 107679442) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,6-dichloro-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]phenol.
| Compound Name | 2,6-dichloro-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]phenol |
|---|---|
| PubChem CID | 107679442 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2,6-dichloro-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]phenol |
| SMILES | CC1(C)C2CCC1(C)C(Nc1cc(Cl)c(O)c(Cl)c1)C2 |
| InChI | InChI=1S/C16H21Cl2NO/c1-15(2)9-4-5-16(15,3)13(6-9)19-10-7-11(17)14(20)12(18)8-10/h7-9,13,19-20H,4-6H2,1-3H3 |
| InChIKey | AJMUPYYEOPIVMT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|