C22H31N5 — CID 68562505
4-N,4-N-dimethyl-2-N-phenyl-6-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-triamine (PubChem CID 68562505) has the molecular formula C22H31N5 and a molecular weight of 365.53 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-phenyl-6-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N,4-N-dimethyl-2-N-phenyl-6-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 68562505 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-phenyl-6-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrimidine-2,4,6-triamine |
| SMILES | CN(C)c1cc(NC2CC3CCC2(C)C3(C)C)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H31N5/c1-21(2)15-11-12-22(21,3)17(13-15)24-18-14-19(27(4)5)26-20(25-18)23-16-9-7-6-8-10-16/h6-10,14-15,17H,11-13H2,1-5H3,(H2,23,24,25,26) |
| InChIKey | MRBZAQZHUCJPPW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |