C9H7Cl2N5O2 — CID 107680298
3-amino-N-(3,5-dichloro-4-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 107680298) has the molecular formula C9H7Cl2N5O2 and a molecular weight of 288.09 g/mol. Its IUPAC name is 3-amino-N-(3,5-dichloro-4-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(3,5-dichloro-4-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 107680298 |
| Molecular Formula | C9H7Cl2N5O2 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 3-amino-N-(3,5-dichloro-4-hydroxyphenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)Nc2cc(Cl)c(O)c(Cl)c2)n1 |
| InChI | InChI=1S/C9H7Cl2N5O2/c10-4-1-3(2-5(11)6(4)17)13-8(18)7-14-9(12)16-15-7/h1-2,17H,(H,13,18)(H3,12,14,15,16) |
| InChIKey | FQYOKNQXNDXBSW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|