C22H18BrN3O7 — CID 10768176
(19S)-7-(2-bromoethoxy)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 10768176) has the molecular formula C22H18BrN3O7 and a molecular weight of 516.30 g/mol. Its IUPAC name is (19S)-7-(2-bromoethoxy)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-7-(2-bromoethoxy)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 10768176 |
| Molecular Formula | C22H18BrN3O7 |
| Molecular Weight | 516.30 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | (19S)-7-(2-bromoethoxy)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c([N+](=O)[O-])c(OCCBr)ccc3nc2-1 |
| InChI | InChI=1S/C22H18BrN3O7/c1-2-22(29)14-8-16-18-11(9-25(16)20(27)13(14)10-33-21(22)28)7-12-15(24-18)3-4-17(32-6-5-23)19(12)26(30)31/h3-4,7-8,29H,2,5-6,9-10H2,1H3/t22-/m0/s1 |
| InChIKey | XSCSKCQDYZZBHG-QFIPXVFZSA-N |
| XLogP | 2.76 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|