C28H32N4O8 — CID 175243185
(19S)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;hexyl 2-aminoacetate (PubChem CID 175243185) has the molecular formula C28H32N4O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is (19S)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;hexyl 2-aminoacetate.
| Compound Name | (19S)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;hexyl 2-aminoacetate |
|---|---|
| PubChem CID | 175243185 |
| Molecular Formula | C28H32N4O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | (19S)-19-ethyl-19-hydroxy-8-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione;hexyl 2-aminoacetate |
| SMILES | CCCCCCOC(=O)CN.CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c([N+](=O)[O-])cccc3nc2-1 |
| InChI | InChI=1S/C20H15N3O6.C8H17NO2/c1-2-20(26)13-7-16-17-10(8-22(16)18(24)12(13)9-29-19(20)25)6-11-14(21-17)4-3-5-15(11)23(27)28;1-2-3-4-5-6-11-8(10)7-9/h3-7,26H,2,8-9H2,1H3;2-7,9H2,1H3/t20-;/m0./s1 |
| InChIKey | RUYSJXIIKSAKKE-BDQAORGHSA-N |
| XLogP | 3.06 |
| TPSA | 176.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|