C27H18N3O7W- — CID 59954856
[(19S)-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] benzoate;tungsten (PubChem CID 59954856) has the molecular formula C27H18N3O7W- and a molecular weight of 680.30 g/mol. Its IUPAC name is [(19S)-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] benzoate;tungsten.
| Compound Name | [(19S)-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] benzoate;tungsten |
|---|---|
| PubChem CID | 59954856 |
| Molecular Formula | C27H18N3O7W- |
| Molecular Weight | 680.30 g/mol |
| Exact Mass | 680.07 |
| IUPAC Name | [(19S)-19-ethyl-8-nitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] benzoate;tungsten |
| SMILES | CC[C@@]1(OC(=O)c2[c-]cccc2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c([N+](=O)[O-])cccc3nc2-1.[W] |
| InChI | InChI=1S/C27H18N3O7.W/c1-2-27(37-25(32)15-7-4-3-5-8-15)19-12-22-23-16(13-29(22)24(31)18(19)14-36-26(27)33)11-17-20(28-23)9-6-10-21(17)30(34)35;/h3-7,9-12H,2,13-14H2,1H3;/q-1;/t27-;/m0./s1 |
| InChIKey | CALRBMACKZNZHU-YCBFMBTMSA-N |
| XLogP | 3.65 |
| TPSA | 130.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|