C27H24N4O9 — CID 174405280
(19-ethyl-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) cyclohexanecarboxylate (PubChem CID 174405280) has the molecular formula C27H24N4O9 and a molecular weight of 548.51 g/mol. Its IUPAC name is (19-ethyl-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) cyclohexanecarboxylate.
| Compound Name | (19-ethyl-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 174405280 |
| Molecular Formula | C27H24N4O9 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (19-ethyl-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) cyclohexanecarboxylate |
| SMILES | CCC1(OC(=O)C2CCCCC2)C(=O)OCc2c1c([N+](=O)[O-])c1n(c2=O)Cc2cc3c([N+](=O)[O-])cccc3nc2-1 |
| InChI | InChI=1S/C27H24N4O9/c1-2-27(40-25(33)14-7-4-3-5-8-14)20-17(13-39-26(27)34)24(32)29-12-15-11-16-18(9-6-10-19(16)30(35)36)28-21(15)23(29)22(20)31(37)38/h6,9-11,14H,2-5,7-8,12-13H2,1H3 |
| InChIKey | PNPWGWKVBUVMJD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 173.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|