C27H27N5O6 — CID 88569994
(19S)-19-ethyl-19-hydroxy-10-[(E)-2-(4-methylpiperazin-1-yl)ethenyl]-21-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 88569994) has the molecular formula C27H27N5O6 and a molecular weight of 517.54 g/mol. Its IUPAC name is (19S)-19-ethyl-19-hydroxy-10-[(E)-2-(4-methylpiperazin-1-yl)ethenyl]-21-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-19-hydroxy-10-[(E)-2-(4-methylpiperazin-1-yl)ethenyl]-21-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 88569994 |
| Molecular Formula | C27H27N5O6 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (19S)-19-ethyl-19-hydroxy-10-[(E)-2-(4-methylpiperazin-1-yl)ethenyl]-21-nitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1c([N+](=O)[O-])c1n(c2=O)Cc2c-1nc1ccccc1c2/C=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C27H27N5O6/c1-3-27(35)21-19(15-38-26(27)34)25(33)31-14-18-16(8-9-30-12-10-29(2)11-13-30)17-6-4-5-7-20(17)28-22(18)24(31)23(21)32(36)37/h4-9,35H,3,10-15H2,1-2H3/b9-8+/t27-/m0/s1 |
| InChIKey | MZAYGGNSLCAFQF-FLXGOCGUSA-N |
| XLogP | 2.21 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|