C27H26N6O10 — CID 88569998
19-ethyl-19-hydroxy-10-[(E)-2-morpholin-4-ylethoxyiminomethyl]-8,21-dinitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 88569998) has the molecular formula C27H26N6O10 and a molecular weight of 594.54 g/mol. Its IUPAC name is 19-ethyl-19-hydroxy-10-[(E)-2-morpholin-4-ylethoxyiminomethyl]-8,21-dinitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 19-ethyl-19-hydroxy-10-[(E)-2-morpholin-4-ylethoxyiminomethyl]-8,21-dinitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 88569998 |
| Molecular Formula | C27H26N6O10 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 19-ethyl-19-hydroxy-10-[(E)-2-morpholin-4-ylethoxyiminomethyl]-8,21-dinitro-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCC1(O)C(=O)OCc2c1c([N+](=O)[O-])c1n(c2=O)Cc2c-1nc1cccc([N+](=O)[O-])c1c2/C=N/OCCN1CCOCC1 |
| InChI | InChI=1S/C27H26N6O10/c1-2-27(36)21-17(14-42-26(27)35)25(34)31-13-16-15(12-28-43-11-8-30-6-9-41-10-7-30)20-18(4-3-5-19(20)32(37)38)29-22(16)24(31)23(21)33(39)40/h3-5,12,36H,2,6-11,13-14H2,1H3/b28-12+ |
| InChIKey | KDJWDIYTJBYAHN-KVSWJAHQSA-N |
| XLogP | 1.58 |
| TPSA | 201.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|