C21H14N4O9 — CID 88569996
19-ethyl-19-hydroxy-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carbaldehyde (PubChem CID 88569996) has the molecular formula C21H14N4O9 and a molecular weight of 466.36 g/mol. Its IUPAC name is 19-ethyl-19-hydroxy-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carbaldehyde.
| Compound Name | 19-ethyl-19-hydroxy-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carbaldehyde |
|---|---|
| PubChem CID | 88569996 |
| Molecular Formula | C21H14N4O9 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 19-ethyl-19-hydroxy-8,21-dinitro-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carbaldehyde |
| SMILES | CCC1(O)C(=O)OCc2c1c([N+](=O)[O-])c1n(c2=O)Cc2c-1nc1cccc([N+](=O)[O-])c1c2C=O |
| InChI | InChI=1S/C21H14N4O9/c1-2-21(29)15-11(8-34-20(21)28)19(27)23-6-9-10(7-26)14-12(4-3-5-13(14)24(30)31)22-16(9)18(23)17(15)25(32)33/h3-5,7,29H,2,6,8H2,1H3 |
| InChIKey | DDFPIHYTUANNCA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 184.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|