C14H19FN2O2 — CID 107685855
N-cyclopropyl-4-[(3-fluoro-4-hydroxyphenyl)methylamino]butanamide (PubChem CID 107685855) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is N-cyclopropyl-4-[(3-fluoro-4-hydroxyphenyl)methylamino]butanamide.
| Compound Name | N-cyclopropyl-4-[(3-fluoro-4-hydroxyphenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 107685855 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-cyclopropyl-4-[(3-fluoro-4-hydroxyphenyl)methylamino]butanamide |
| SMILES | O=C(CCCNCc1ccc(O)c(F)c1)NC1CC1 |
| InChI | InChI=1S/C14H19FN2O2/c15-12-8-10(3-6-13(12)18)9-16-7-1-2-14(19)17-11-4-5-11/h3,6,8,11,16,18H,1-2,4-5,7,9H2,(H,17,19) |
| InChIKey | NXOLRNUBZFYNEG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|