C14H18BrFN2O — CID 79393798
4-[(2-bromo-4-fluorophenyl)methylamino]-N-cyclopropylbutanamide (PubChem CID 79393798) has the molecular formula C14H18BrFN2O and a molecular weight of 329.21 g/mol. Its IUPAC name is 4-[(2-bromo-4-fluorophenyl)methylamino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(2-bromo-4-fluorophenyl)methylamino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79393798 |
| Molecular Formula | C14H18BrFN2O |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[(2-bromo-4-fluorophenyl)methylamino]-N-cyclopropylbutanamide |
| SMILES | O=C(CCCNCc1ccc(F)cc1Br)NC1CC1 |
| InChI | InChI=1S/C14H18BrFN2O/c15-13-8-11(16)4-3-10(13)9-17-7-1-2-14(19)18-12-5-6-12/h3-4,8,12,17H,1-2,5-7,9H2,(H,18,19) |
| InChIKey | UTIUXWVCIRTCHD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|